C25H35N5O4 — CID 58756848
prop-2-enyl N-[(2S)-6-amino-1-[[(2S)-3-(1-methylindol-3-yl)-1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]-1-oxohexan-2-yl]carbamate (PubChem CID 58756848) has the molecular formula C25H35N5O4 and a molecular weight of 469.59 g/mol. Its IUPAC name is prop-2-enyl N-[(2S)-6-amino-1-[[(2S)-3-(1-methylindol-3-yl)-1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[(2S)-6-amino-1-[[(2S)-3-(1-methylindol-3-yl)-1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58756848 |
| Molecular Formula | C25H35N5O4 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | prop-2-enyl N-[(2S)-6-amino-1-[[(2S)-3-(1-methylindol-3-yl)-1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]-1-oxohexan-2-yl]carbamate |
| SMILES | C=CCNC(=O)[C@H](Cc1cn(C)c2ccccc12)NC(=O)[C@H](CCCCN)NC(=O)OCC=C |
| InChI | InChI=1S/C25H35N5O4/c1-4-14-27-23(31)21(16-18-17-30(3)22-12-7-6-10-19(18)22)28-24(32)20(11-8-9-13-26)29-25(33)34-15-5-2/h4-7,10,12,17,20-21H,1-2,8-9,11,13-16,26H2,3H3,(H,27,31)(H,28,32)(H,29,33)/t20-,21-/m0/s1 |
| InChIKey | HUJCIRHWXDVMSN-SFTDATJTSA-N |
| XLogP | 1.92 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|