C13H13N5O2 — CID 164909288
[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] acetate (PubChem CID 164909288) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] acetate.
| Compound Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] acetate |
|---|---|
| PubChem CID | 164909288 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1/N=N/c1ccc(N)nc1N |
| InChI | InChI=1S/C13H13N5O2/c1-8(19)20-11-5-3-2-4-9(11)17-18-10-6-7-12(14)16-13(10)15/h2-7H,1H3,(H4,14,15,16)/b18-17+ |
| InChIKey | MOPYDRLMDDUMDA-ISLYRVAYSA-N |
| XLogP | 2.59 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|