C14H15N5O2 — CID 164908733
N-[6-amino-3-[(2-methoxyphenyl)diazenyl]-2-pyridinyl]acetamide (PubChem CID 164908733) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is N-[6-amino-3-[(2-methoxyphenyl)diazenyl]-2-pyridinyl]acetamide.
| Compound Name | N-[6-amino-3-[(2-methoxyphenyl)diazenyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 164908733 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[6-amino-3-[(2-methoxyphenyl)diazenyl]-2-pyridinyl]acetamide |
| SMILES | COc1ccccc1/N=N/c1ccc(N)nc1NC(C)=O |
| InChI | InChI=1S/C14H15N5O2/c1-9(20)16-14-11(7-8-13(15)17-14)19-18-10-5-3-4-6-12(10)21-2/h3-8H,1-2H3,(H3,15,16,17,20)/b19-18+ |
| InChIKey | PYIRZNSNQWRNLV-VHEBQXMUSA-N |
| XLogP | 3.05 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|