C20H27N5O2 — CID 90726409
(3-ethyl-2-methylpentyl) N-(6-amino-3-phenyldiazenyl-2-pyridinyl)carbamate (PubChem CID 90726409) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is (3-ethyl-2-methylpentyl) N-(6-amino-3-phenyldiazenyl-2-pyridinyl)carbamate.
| Compound Name | (3-ethyl-2-methylpentyl) N-(6-amino-3-phenyldiazenyl-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 90726409 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (3-ethyl-2-methylpentyl) N-(6-amino-3-phenyldiazenyl-2-pyridinyl)carbamate |
| SMILES | CCC(CC)C(C)COC(=O)Nc1nc(N)ccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C20H27N5O2/c1-4-15(5-2)14(3)13-27-20(26)23-19-17(11-12-18(21)22-19)25-24-16-9-7-6-8-10-16/h6-12,14-15H,4-5,13H2,1-3H3,(H3,21,22,23,26)/b25-24+ |
| InChIKey | SQQZCALSLBUWSA-OCOZRVBESA-N |
| XLogP | 5.70 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|