C11H13N5O — CID 139146043
3-phenyldiazenylpyridine-2,6-diamine;hydrate (PubChem CID 139146043) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 3-phenyldiazenylpyridine-2,6-diamine;hydrate.
| Compound Name | 3-phenyldiazenylpyridine-2,6-diamine;hydrate |
|---|---|
| PubChem CID | 139146043 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3-phenyldiazenylpyridine-2,6-diamine;hydrate |
| SMILES | Nc1ccc(/N=N/c2ccccc2)c(N)n1.O |
| InChI | InChI=1S/C11H11N5.H2O/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;/h1-7H,(H4,12,13,14);1H2/b16-15+; |
| InChIKey | JJPOBGUFHBGRMQ-GEEYTBSJSA-N |
| XLogP | 1.84 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|