C16H19N6+ — CID 147137280
[(6-amino-5-phenyldiazenyl-2-pyridinyl)amino]methyl-(cyclobuten-1-yl)azanium (PubChem CID 147137280) has the molecular formula C16H19N6+ and a molecular weight of 295.37 g/mol. Its IUPAC name is [(6-amino-5-phenyldiazenyl-2-pyridinyl)amino]methyl-(cyclobuten-1-yl)azanium.
| Compound Name | [(6-amino-5-phenyldiazenyl-2-pyridinyl)amino]methyl-(cyclobuten-1-yl)azanium |
|---|---|
| PubChem CID | 147137280 |
| Molecular Formula | C16H19N6+ |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [(6-amino-5-phenyldiazenyl-2-pyridinyl)amino]methyl-(cyclobuten-1-yl)azanium |
| SMILES | Nc1nc(NC[NH2+]C2=CCC2)ccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C16H18N6/c17-16-14(22-21-13-5-2-1-3-6-13)9-10-15(20-16)19-11-18-12-7-4-8-12/h1-3,5-7,9-10,18H,4,8,11H2,(H3,17,19,20)/p+1/b22-21+ |
| InChIKey | BRKKCSUWUTUIMP-QURGRASLSA-O |
| XLogP | 2.69 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|