C12H10N6O — CID 136821633
5-amino-6-phenyldiazenyl-1,3-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 136821633) has the molecular formula C12H10N6O and a molecular weight of 254.25 g/mol. Its IUPAC name is 5-amino-6-phenyldiazenyl-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-amino-6-phenyldiazenyl-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 136821633 |
| Molecular Formula | C12H10N6O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-amino-6-phenyldiazenyl-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | Nc1nc2[nH]c(=O)[nH]c2cc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C12H10N6O/c13-10-8(18-17-7-4-2-1-3-5-7)6-9-11(15-10)16-12(19)14-9/h1-6H,(H4,13,14,15,16,19)/b18-17+ |
| InChIKey | OMKAXWUKJFQUDZ-ISLYRVAYSA-N |
| XLogP | 2.25 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|