C13H13N5O3 — CID 174261670
N-[6-amino-3-hydroxy-5-[(4-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide (PubChem CID 174261670) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is N-[6-amino-3-hydroxy-5-[(4-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide.
| Compound Name | N-[6-amino-3-hydroxy-5-[(4-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 174261670 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-[6-amino-3-hydroxy-5-[(4-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1nc(N)c(/N=N/c2ccc(O)cc2)cc1O |
| InChI | InChI=1S/C13H13N5O3/c1-7(19)15-13-11(21)6-10(12(14)16-13)18-17-8-2-4-9(20)5-3-8/h2-6,20-21H,1H3,(H3,14,15,16,19)/b18-17+ |
| InChIKey | HOXBSUWWFPTQQU-ISLYRVAYSA-N |
| XLogP | 2.45 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|