C15H15F3N6O4 — CID 175969064
2-amino-N-[6-amino-5-[(2-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 175969064) has the molecular formula C15H15F3N6O4 and a molecular weight of 400.32 g/mol. Its IUPAC name is 2-amino-N-[6-amino-5-[(2-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-N-[6-amino-5-[(2-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175969064 |
| Molecular Formula | C15H15F3N6O4 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-amino-N-[6-amino-5-[(2-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | NCC(=O)Nc1ccc(/N=N/c2ccccc2O)c(N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H14N6O2.C2HF3O2/c14-7-12(21)16-11-6-5-9(13(15)17-11)19-18-8-3-1-2-4-10(8)20;3-2(4,5)1(6)7/h1-6,20H,7,14H2,(H3,15,16,17,21);(H,6,7)/b19-18+; |
| InChIKey | HSKXHUMAEVTOFL-LTRPLHCISA-N |
| XLogP | 2.32 |
| TPSA | 176.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|