C15H13F3N6O3 — CID 175516437
[2-[[2-amino-6-[(2-aminoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 175516437) has the molecular formula C15H13F3N6O3 and a molecular weight of 382.30 g/mol. Its IUPAC name is [2-[[2-amino-6-[(2-aminoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[[2-amino-6-[(2-aminoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175516437 |
| Molecular Formula | C15H13F3N6O3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [2-[[2-amino-6-[(2-aminoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | NCC(=O)Nc1ccc(/N=N/c2ccccc2OC(=O)C(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C15H13F3N6O3/c16-15(17,18)14(26)27-10-4-2-1-3-8(10)23-24-9-5-6-11(22-13(9)20)21-12(25)7-19/h1-6H,7,19H2,(H3,20,21,22,25)/b24-23+ |
| InChIKey | KDZRMFZNQWTGQX-WCWDXBQESA-N |
| XLogP | 2.44 |
| TPSA | 145.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|