C17H13N5O2 — CID 135692487
6-hydroxy-3,5-bis(phenyldiazenyl)-1H-pyridin-2-one (PubChem CID 135692487) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 6-hydroxy-3,5-bis(phenyldiazenyl)-1H-pyridin-2-one.
| Compound Name | 6-hydroxy-3,5-bis(phenyldiazenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 135692487 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 6-hydroxy-3,5-bis(phenyldiazenyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(O)c(/N=N/c2ccccc2)cc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C17H13N5O2/c23-16-14(21-19-12-7-3-1-4-8-12)11-15(17(24)18-16)22-20-13-9-5-2-6-10-13/h1-11H,(H2,18,23,24)/b21-19+,22-20+ |
| InChIKey | IDJMEINYLPQVJO-FLFKKZLDSA-N |
| XLogP | 4.91 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|