C13H10N4O — CID 135407267
4-methyl-2-oxo-5-phenyldiazenyl-1H-pyridine-3-carbonitrile (PubChem CID 135407267) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-methyl-2-oxo-5-phenyldiazenyl-1H-pyridine-3-carbonitrile.
| Compound Name | 4-methyl-2-oxo-5-phenyldiazenyl-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135407267 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-methyl-2-oxo-5-phenyldiazenyl-1H-pyridine-3-carbonitrile |
| SMILES | Cc1c(/N=N/c2ccccc2)c[nH]c(=O)c1C#N |
| InChI | InChI=1S/C13H10N4O/c1-9-11(7-14)13(18)15-8-12(9)17-16-10-5-3-2-4-6-10/h2-6,8H,1H3,(H,15,18)/b17-16+ |
| InChIKey | RZCIFKHAKVTNOV-WUKNDPDISA-N |
| XLogP | 2.97 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|