C8H7N3O — CID 818624
5-methanimidoyl-4-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 818624) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 5-methanimidoyl-4-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 5-methanimidoyl-4-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 818624 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 5-methanimidoyl-4-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | [H]/N=C/c1c[nH]c(=O)c(C#N)c1C |
| InChI | InChI=1S/C8H7N3O/c1-5-6(2-9)4-11-8(12)7(5)3-10/h2,4,9H,1H3,(H,11,12)/b9-2+ |
| InChIKey | ARJIYENPUUXFJT-XNWCZRBMSA-N |
| XLogP | 0.55 |
| TPSA | 80.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|