C15H11N5O — CID 136729022
5-[(3-cyanophenyl)diazenyl]-4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 136729022) has the molecular formula C15H11N5O and a molecular weight of 277.29 g/mol. Its IUPAC name is 5-[(3-cyanophenyl)diazenyl]-4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 5-[(3-cyanophenyl)diazenyl]-4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 136729022 |
| Molecular Formula | C15H11N5O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-[(3-cyanophenyl)diazenyl]-4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1[nH]c(=O)c(C#N)c(C)c1/N=N/c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H11N5O/c1-9-13(8-17)15(21)18-10(2)14(9)20-19-12-5-3-4-11(6-12)7-16/h3-6H,1-2H3,(H,18,21)/b20-19+ |
| InChIKey | XAYGROFROFAHAL-FMQUCBEESA-N |
| XLogP | 3.15 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|