C19H13ClN4O — CID 137207284
5-[(4-chlorophenyl)diazenyl]-4-methyl-2-oxo-6-phenyl-1H-pyridine-3-carbonitrile (PubChem CID 137207284) has the molecular formula C19H13ClN4O and a molecular weight of 348.79 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)diazenyl]-4-methyl-2-oxo-6-phenyl-1H-pyridine-3-carbonitrile.
| Compound Name | 5-[(4-chlorophenyl)diazenyl]-4-methyl-2-oxo-6-phenyl-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 137207284 |
| Molecular Formula | C19H13ClN4O |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 5-[(4-chlorophenyl)diazenyl]-4-methyl-2-oxo-6-phenyl-1H-pyridine-3-carbonitrile |
| SMILES | Cc1c(/N=N/c2ccc(Cl)cc2)c(-c2ccccc2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C19H13ClN4O/c1-12-16(11-21)19(25)22-18(13-5-3-2-4-6-13)17(12)24-23-15-9-7-14(20)8-10-15/h2-10H,1H3,(H,22,25)/b24-23+ |
| InChIKey | BZUDAVREXMPIHF-WCWDXBQESA-N |
| XLogP | 5.29 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|