C23H17N5O — CID 136862773
6-anilino-4-methyl-5-(naphthalen-1-yldiazenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 136862773) has the molecular formula C23H17N5O and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-anilino-4-methyl-5-(naphthalen-1-yldiazenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-anilino-4-methyl-5-(naphthalen-1-yldiazenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 136862773 |
| Molecular Formula | C23H17N5O |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 6-anilino-4-methyl-5-(naphthalen-1-yldiazenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1c(/N=N/c2cccc3ccccc23)c(Nc2ccccc2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C23H17N5O/c1-15-19(14-24)23(29)26-22(25-17-10-3-2-4-11-17)21(15)28-27-20-13-7-9-16-8-5-6-12-18(16)20/h2-13H,1H3,(H2,25,26,29)/b28-27+ |
| InChIKey | DMHPTOLIHWKYMI-BYYHNAKLSA-N |
| XLogP | 5.87 |
| TPSA | 93.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|