C14H11N5O3 — CID 137062042
2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzamide (PubChem CID 137062042) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzamide.
| Compound Name | 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzamide |
|---|---|
| PubChem CID | 137062042 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzamide |
| SMILES | Cc1c(C#N)c(O)[nH]c(=O)c1/N=N/c1ccccc1C(N)=O |
| InChI | InChI=1S/C14H11N5O3/c1-7-9(6-15)13(21)17-14(22)11(7)19-18-10-5-3-2-4-8(10)12(16)20/h2-5H,1H3,(H2,16,20)(H2,17,21,22)/b19-18+ |
| InChIKey | IIRRWYJWFSEXJC-VHEBQXMUSA-N |
| XLogP | 1.77 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|