C16H16BrN5O4S — CID 137198638
N-(3-bromopropyl)-4-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonamide (PubChem CID 137198638) has the molecular formula C16H16BrN5O4S and a molecular weight of 454.31 g/mol. Its IUPAC name is N-(3-bromopropyl)-4-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonamide.
| Compound Name | N-(3-bromopropyl)-4-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 137198638 |
| Molecular Formula | C16H16BrN5O4S |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | N-(3-bromopropyl)-4-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonamide |
| SMILES | Cc1c(C#N)c(O)[nH]c(=O)c1/N=N/c1ccc(S(=O)(=O)NCCCBr)cc1 |
| InChI | InChI=1S/C16H16BrN5O4S/c1-10-13(9-18)15(23)20-16(24)14(10)22-21-11-3-5-12(6-4-11)27(25,26)19-8-2-7-17/h3-6,19H,2,7-8H2,1H3,(H2,20,23,24)/b22-21+ |
| InChIKey | LMUVFGIACZHWRS-QURGRASLSA-N |
| XLogP | 2.74 |
| TPSA | 147.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|