C19H22N4O9S2 — CID 136679307
2-[4-[[5-cyano-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 136679307) has the molecular formula C19H22N4O9S2 and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-[4-[[5-cyano-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[[5-cyano-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 136679307 |
| Molecular Formula | C19H22N4O9S2 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 2-[4-[[5-cyano-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | COCCCn1c(O)c(C#N)c(C)c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)c1=O |
| InChI | InChI=1S/C19H22N4O9S2/c1-13-16(12-20)18(24)23(8-3-9-31-2)19(25)17(13)22-21-14-4-6-15(7-5-14)33(26,27)11-10-32-34(28,29)30/h4-7,24H,3,8-11H2,1-2H3,(H,28,29,30)/b22-21+ |
| InChIKey | HEPXSFNJRQMAJL-QURGRASLSA-N |
| XLogP | 1.78 |
| TPSA | 197.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|