C31H47N5O3 — CID 159881339
2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]-N,N-bis(2-ethylhexyl)benzamide;methane (PubChem CID 159881339) has the molecular formula C31H47N5O3 and a molecular weight of 537.75 g/mol. Its IUPAC name is 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]-N,N-bis(2-ethylhexyl)benzamide;methane.
| Compound Name | 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]-N,N-bis(2-ethylhexyl)benzamide;methane |
|---|---|
| PubChem CID | 159881339 |
| Molecular Formula | C31H47N5O3 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.37 |
| IUPAC Name | 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1H-pyridin-3-yl)diazenyl]-N,N-bis(2-ethylhexyl)benzamide;methane |
| SMILES | C.CCCCC(CC)CN(CC(CC)CCCC)C(=O)c1ccccc1/N=N/c1c(C)c(C#N)c(O)[nH]c1=O |
| InChI | InChI=1S/C30H43N5O3.CH4/c1-6-10-14-22(8-3)19-35(20-23(9-4)15-11-7-2)30(38)24-16-12-13-17-26(24)33-34-27-21(5)25(18-31)28(36)32-29(27)37;/h12-13,16-17,22-23H,6-11,14-15,19-20H2,1-5H3,(H2,32,36,37);1H4/b34-33+; |
| InChIKey | NTOHZZAHPUUTFL-GGTLNOMSSA-N |
| XLogP | 8.19 |
| TPSA | 121.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|