C35H47N5O4S — CID 140899746
2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1-phenyl-3-pyridinyl)diazenyl]-N,N-bis(2-ethylhexyl)benzenesulfonamide (PubChem CID 140899746) has the molecular formula C35H47N5O4S and a molecular weight of 633.86 g/mol. Its IUPAC name is 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1-phenyl-3-pyridinyl)diazenyl]-N,N-bis(2-ethylhexyl)benzenesulfonamide.
| Compound Name | 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1-phenyl-3-pyridinyl)diazenyl]-N,N-bis(2-ethylhexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 140899746 |
| Molecular Formula | C35H47N5O4S |
| Molecular Weight | 633.86 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | 2-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1-phenyl-3-pyridinyl)diazenyl]-N,N-bis(2-ethylhexyl)benzenesulfonamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)S(=O)(=O)c1ccccc1/N=N/c1c(C)c(C#N)c(O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C35H47N5O4S/c1-6-10-17-27(8-3)24-39(25-28(9-4)18-11-7-2)45(43,44)32-22-16-15-21-31(32)37-38-33-26(5)30(23-36)34(41)40(35(33)42)29-19-13-12-14-20-29/h12-16,19-22,27-28,41H,6-11,17-18,24-25H2,1-5H3/b38-37+ |
| InChIKey | URKRGLGBSPCAES-HEFFKOSUSA-N |
| XLogP | 8.56 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.86 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|