C14H9Cl2N3O — CID 3485127
4,6-dichloro-3-phenyldiazenyl-2H-isoindol-1-ol (PubChem CID 3485127) has the molecular formula C14H9Cl2N3O and a molecular weight of 306.15 g/mol. Its IUPAC name is 4,6-dichloro-3-phenyldiazenyl-2H-isoindol-1-ol.
| Compound Name | 4,6-dichloro-3-phenyldiazenyl-2H-isoindol-1-ol |
|---|---|
| PubChem CID | 3485127 |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4,6-dichloro-3-phenyldiazenyl-2H-isoindol-1-ol |
| SMILES | Oc1[nH]c(/N=N/c2ccccc2)c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C14H9Cl2N3O/c15-8-6-10-12(11(16)7-8)13(17-14(10)20)19-18-9-4-2-1-3-5-9/h1-7,17,20H/b19-18+ |
| InChIKey | SATYWENCWXNHLQ-VHEBQXMUSA-N |
| XLogP | 5.60 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|