C14H8Cl4N2 — CID 134921361
[(E)-1-chloro-2-(2,4,6-trichlorophenyl)ethenyl]-phenyldiazene (PubChem CID 134921361) has the molecular formula C14H8Cl4N2 and a molecular weight of 346.04 g/mol. Its IUPAC name is [(E)-1-chloro-2-(2,4,6-trichlorophenyl)ethenyl]-phenyldiazene.
| Compound Name | [(E)-1-chloro-2-(2,4,6-trichlorophenyl)ethenyl]-phenyldiazene |
|---|---|
| PubChem CID | 134921361 |
| Molecular Formula | C14H8Cl4N2 |
| Molecular Weight | 346.04 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | [(E)-1-chloro-2-(2,4,6-trichlorophenyl)ethenyl]-phenyldiazene |
| SMILES | ClC(=C/c1c(Cl)cc(Cl)cc1Cl)/N=N/c1ccccc1 |
| InChI | InChI=1S/C14H8Cl4N2/c15-9-6-12(16)11(13(17)7-9)8-14(18)20-19-10-4-2-1-3-5-10/h1-8H/b14-8-,20-19+ |
| InChIKey | COVZZYFGXCABHY-JSQZLVBHSA-N |
| XLogP | 6.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.04 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|