C12H11N5O2 — CID 164908675
[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] formate (PubChem CID 164908675) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] formate.
| Compound Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] formate |
|---|---|
| PubChem CID | 164908675 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] formate |
| SMILES | Nc1ccc(/N=N/c2ccccc2OC=O)c(N)n1 |
| InChI | InChI=1S/C12H11N5O2/c13-11-6-5-9(12(14)15-11)17-16-8-3-1-2-4-10(8)19-7-18/h1-7H,(H4,13,14,15)/b17-16+ |
| InChIKey | LTFCHLGQQOHZQU-WUKNDPDISA-N |
| XLogP | 2.20 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|