C14H15N5O2 — CID 175516329
phenyl 3-[(2,6-diamino-3-pyridinyl)diazenyl]propanoate (PubChem CID 175516329) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is phenyl 3-[(2,6-diamino-3-pyridinyl)diazenyl]propanoate.
| Compound Name | phenyl 3-[(2,6-diamino-3-pyridinyl)diazenyl]propanoate |
|---|---|
| PubChem CID | 175516329 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | phenyl 3-[(2,6-diamino-3-pyridinyl)diazenyl]propanoate |
| SMILES | Nc1ccc(/N=N/CCC(=O)Oc2ccccc2)c(N)n1 |
| InChI | InChI=1S/C14H15N5O2/c15-12-7-6-11(14(16)18-12)19-17-9-8-13(20)21-10-4-2-1-3-5-10/h1-7H,8-9H2,(H4,15,16,18)/b19-17+ |
| InChIKey | LDUJOAAEOGVXLE-HTXNQAPBSA-N |
| XLogP | 2.33 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|