About phenyl 2-selanylacetate
phenyl 2-selanylacetate (PubChem CID 174249881) has the molecular formula C8H8O2Se
and a molecular weight of 215.11 g/mol. Its IUPAC name is phenyl 2-selanylacetate.
Molecular Properties
| Compound Name | phenyl 2-selanylacetate |
| PubChem CID | 174249881 |
| Molecular Formula | C8H8O2Se |
| Molecular Weight | 215.11 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | phenyl 2-selanylacetate |
| SMILES | O=C(C[SeH])Oc1ccccc1 |
| InChI | InChI=1S/C8H8O2Se/c9-8(6-11)10-7-4-2-1-3-5-7/h1-5,11H,6H2 |
| InChIKey | AOMGXBXSKQZPQY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.11 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-selanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-selanylacetate?
The IUPAC name of phenyl 2-selanylacetate (CID 174249881) is phenyl 2-selanylacetate.
What is the SMILES notation for phenyl 2-selanylacetate?
The canonical SMILES for phenyl 2-selanylacetate is O=C(C[SeH])Oc1ccccc1.
What is the InChIKey of phenyl 2-selanylacetate?
The InChIKey is AOMGXBXSKQZPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2Se/c9-8(6-11)10-7-4-2-1-3-5-7/h1-5,11H,6H2.
What are the key properties of phenyl 2-selanylacetate?
phenyl 2-selanylacetate has a molecular weight of 215.11 g/mol, XLogP of 0.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-selanylacetate is sourced from PubChem (CID 174249881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).