C17H20N6O4 — CID 164909088
(2R)-2-[[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenoxy]carbonylamino]-3-methylbutanoic acid (PubChem CID 164909088) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is (2R)-2-[[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenoxy]carbonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenoxy]carbonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 164909088 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (2R)-2-[[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenoxy]carbonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)Oc1ccccc1/N=N/c1ccc(N)nc1N)C(=O)O |
| InChI | InChI=1S/C17H20N6O4/c1-9(2)14(16(24)25)21-17(26)27-12-6-4-3-5-10(12)22-23-11-7-8-13(18)20-15(11)19/h3-9,14H,1-2H3,(H,21,26)(H,24,25)(H4,18,19,20)/b23-22+/t14-/m1/s1 |
| InChIKey | YWOGITNEZPKQFI-DGIAWOHRSA-N |
| XLogP | 2.86 |
| TPSA | 165.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|