C15H19N6O4P — CID 174260701
[2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]-methylphosphinic acid (PubChem CID 174260701) has the molecular formula C15H19N6O4P and a molecular weight of 378.33 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]-methylphosphinic acid.
| Compound Name | [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]-methylphosphinic acid |
|---|---|
| PubChem CID | 174260701 |
| Molecular Formula | C15H19N6O4P |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]-methylphosphinic acid |
| SMILES | C[C@H](N)C(=O)Nc1ccc(/N=N/c2ccccc2OP(C)(=O)O)c(N)n1 |
| InChI | InChI=1S/C15H19N6O4P/c1-9(16)15(22)19-13-8-7-11(14(17)18-13)21-20-10-5-3-4-6-12(10)25-26(2,23)24/h3-9H,16H2,1-2H3,(H,23,24)(H3,17,18,19,22)/b21-20+/t9-/m0/s1 |
| InChIKey | BSPUZTZUXGWFMX-MUQGCMKUSA-N |
| XLogP | 2.56 |
| TPSA | 165.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|