C17H24N7O5P — CID 174260835
[2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] dihydrogen phosphate (PubChem CID 174260835) has the molecular formula C17H24N7O5P and a molecular weight of 437.40 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] dihydrogen phosphate.
| Compound Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 174260835 |
| Molecular Formula | C17H24N7O5P |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] dihydrogen phosphate |
| SMILES | NCCCC[C@H](N)C(=O)Nc1ccc(/N=N/c2ccccc2OP(=O)(O)O)c(N)n1 |
| InChI | InChI=1S/C17H24N7O5P/c18-10-4-3-5-11(19)17(25)22-15-9-8-13(16(20)21-15)24-23-12-6-1-2-7-14(12)29-30(26,27)28/h1-2,6-9,11H,3-5,10,18-19H2,(H2,26,27,28)(H3,20,21,22,25)/b24-23+/t11-/m0/s1 |
| InChIKey | ZQHMVMPBBDEIDL-LQYYBXHWSA-N |
| XLogP | 1.95 |
| TPSA | 211.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|