C11H20N6O — CID 164908599
2,6-diamino-N-(5,6-diamino-2-pyridinyl)hexanamide (PubChem CID 164908599) has the molecular formula C11H20N6O and a molecular weight of 252.32 g/mol. Its IUPAC name is 2,6-diamino-N-(5,6-diamino-2-pyridinyl)hexanamide.
| Compound Name | 2,6-diamino-N-(5,6-diamino-2-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 164908599 |
| Molecular Formula | C11H20N6O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2,6-diamino-N-(5,6-diamino-2-pyridinyl)hexanamide |
| SMILES | NCCCCC(N)C(=O)Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C11H20N6O/c12-6-2-1-3-8(14)11(18)17-9-5-4-7(13)10(15)16-9/h4-5,8H,1-3,6,12-14H2,(H3,15,16,17,18) |
| InChIKey | SVEBYXLZFSKVCA-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|