C23H37N7O5 — CID 164909178
1-(2-aminophenoxy)ethyl propan-2-yl carbonate;2,6-diamino-N-(5,6-diamino-2-pyridinyl)hexanamide (PubChem CID 164909178) has the molecular formula C23H37N7O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is 1-(2-aminophenoxy)ethyl propan-2-yl carbonate;2,6-diamino-N-(5,6-diamino-2-pyridinyl)hexanamide.
| Compound Name | 1-(2-aminophenoxy)ethyl propan-2-yl carbonate;2,6-diamino-N-(5,6-diamino-2-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 164909178 |
| Molecular Formula | C23H37N7O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 1-(2-aminophenoxy)ethyl propan-2-yl carbonate;2,6-diamino-N-(5,6-diamino-2-pyridinyl)hexanamide |
| SMILES | CC(C)OC(=O)OC(C)Oc1ccccc1N.NCCCCC(N)C(=O)Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C12H17NO4.C11H20N6O/c1-8(2)15-12(14)17-9(3)16-11-7-5-4-6-10(11)13;12-6-2-1-3-8(14)11(18)17-9-5-4-7(13)10(15)16-9/h4-9H,13H2,1-3H3;4-5,8H,1-3,6,12-14H2,(H3,15,16,17,18) |
| InChIKey | KVDAIXRTOINPTE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 216.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|