C20H26N6O5 — CID 164908836
1-[2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]ethyl propan-2-yl carbonate (PubChem CID 164908836) has the molecular formula C20H26N6O5 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-[2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]ethyl propan-2-yl carbonate.
| Compound Name | 1-[2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]ethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 164908836 |
| Molecular Formula | C20H26N6O5 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]ethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OC(C)Oc1ccccc1/N=N/c1ccc(NC(=O)[C@H](C)N)nc1N |
| InChI | InChI=1S/C20H26N6O5/c1-11(2)29-20(28)31-13(4)30-16-8-6-5-7-14(16)25-26-15-9-10-17(23-18(15)22)24-19(27)12(3)21/h5-13H,21H2,1-4H3,(H3,22,23,24,27)/b26-25+/t12-,13?/m0/s1 |
| InChIKey | FNBVSTXYDUDIFS-IRNVQTPYSA-N |
| XLogP | 3.65 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|