C20H27N7O4 — CID 174263867
[2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 3-hydroxypropanoate (PubChem CID 174263867) has the molecular formula C20H27N7O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 3-hydroxypropanoate.
| Compound Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 3-hydroxypropanoate |
|---|---|
| PubChem CID | 174263867 |
| Molecular Formula | C20H27N7O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 3-hydroxypropanoate |
| SMILES | NCCCC[C@H](N)C(=O)Nc1ccc(/N=N/c2ccccc2OC(=O)CCO)c(N)n1 |
| InChI | InChI=1S/C20H27N7O4/c21-11-4-3-5-13(22)20(30)25-17-9-8-15(19(23)24-17)27-26-14-6-1-2-7-16(14)31-18(29)10-12-28/h1-2,6-9,13,28H,3-5,10-12,21-22H2,(H3,23,24,25,30)/b27-26+/t13-/m0/s1 |
| InChIKey | RNMWBBRLVCHHQZ-IEUSNURDSA-N |
| XLogP | 1.76 |
| TPSA | 191.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|