C23H32N8O3 — CID 164908728
[2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-pyrrolidin-1-ylacetate (PubChem CID 164908728) has the molecular formula C23H32N8O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-pyrrolidin-1-ylacetate.
| Compound Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-pyrrolidin-1-ylacetate |
|---|---|
| PubChem CID | 164908728 |
| Molecular Formula | C23H32N8O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-pyrrolidin-1-ylacetate |
| SMILES | NCCCC[C@H](N)C(=O)Nc1ccc(/N=N/c2ccccc2OC(=O)CN2CCCC2)c(N)n1 |
| InChI | InChI=1S/C23H32N8O3/c24-12-4-3-7-16(25)23(33)28-20-11-10-18(22(26)27-20)30-29-17-8-1-2-9-19(17)34-21(32)15-31-13-5-6-14-31/h1-2,8-11,16H,3-7,12-15,24-25H2,(H3,26,27,28,33)/b30-29+/t16-/m0/s1 |
| InChIKey | QNJPLYRXSZOKHN-OOEOAJENSA-N |
| XLogP | 2.48 |
| TPSA | 174.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|