C21H29N7O3 — CID 174260521
[2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-methylpropanoate (PubChem CID 174260521) has the molecular formula C21H29N7O3 and a molecular weight of 427.51 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-methylpropanoate.
| Compound Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 174260521 |
| Molecular Formula | C21H29N7O3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccccc1/N=N/c1ccc(NC(=O)[C@@H](N)CCCCN)nc1N |
| InChI | InChI=1S/C21H29N7O3/c1-13(2)21(30)31-17-9-4-3-8-15(17)27-28-16-10-11-18(25-19(16)24)26-20(29)14(23)7-5-6-12-22/h3-4,8-11,13-14H,5-7,12,22-23H2,1-2H3,(H3,24,25,26,29)/b28-27+/t14-/m0/s1 |
| InChIKey | MFSFGGORMCGPTH-JPFQVMLPSA-N |
| XLogP | 3.04 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|