C14H19N5O3 — CID 164909161
2-methoxyaniline;methyl N-(5,6-diamino-2-pyridinyl)carbamate (PubChem CID 164909161) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-methoxyaniline;methyl N-(5,6-diamino-2-pyridinyl)carbamate.
| Compound Name | 2-methoxyaniline;methyl N-(5,6-diamino-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 164909161 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-methoxyaniline;methyl N-(5,6-diamino-2-pyridinyl)carbamate |
| SMILES | COC(=O)Nc1ccc(N)c(N)n1.COc1ccccc1N |
| InChI | InChI=1S/C7H10N4O2.C7H9NO/c1-13-7(12)11-5-3-2-4(8)6(9)10-5;1-9-7-5-3-2-4-6(7)8/h2-3H,8H2,1H3,(H3,9,10,11,12);2-5H,8H2,1H3 |
| InChIKey | YZXZCSRGJWLBQJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|