C18H20BN6O3 — CID 164909055
CID 164909055 (PubChem CID 164909055) has the molecular formula C18H20BN6O3 and a molecular weight of 379.21 g/mol.
| Compound Name | CID 164909055 |
|---|---|
| PubChem CID | 164909055 |
| Molecular Formula | C18H20BN6O3 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | — |
| SMILES | N#C[B]CC(=O)Nc1ccc(N)c(N)n1.Nc1ccccc1OC(=O)C1CC1 |
| InChI | InChI=1S/C10H11NO2.C8H9BN5O/c11-8-3-1-2-4-9(8)13-10(12)7-5-6-7;10-4-9-3-7(15)13-6-2-1-5(11)8(12)14-6/h1-4,7H,5-6,11H2;1-2H,3,11H2,(H3,12,13,14,15) |
| InChIKey | AGOMPOIHUGZOSW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|