C20H27N7O5 — CID 164908587
[2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]methyl methyl carbonate (PubChem CID 164908587) has the molecular formula C20H27N7O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]methyl methyl carbonate.
| Compound Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]methyl methyl carbonate |
|---|---|
| PubChem CID | 164908587 |
| Molecular Formula | C20H27N7O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [2-[[2-amino-6-[[(2S)-2,6-diaminohexanoyl]amino]-3-pyridinyl]diazenyl]phenoxy]methyl methyl carbonate |
| SMILES | COC(=O)OCOc1ccccc1/N=N/c1ccc(NC(=O)[C@@H](N)CCCCN)nc1N |
| InChI | InChI=1S/C20H27N7O5/c1-30-20(29)32-12-31-16-8-3-2-7-14(16)26-27-15-9-10-17(24-18(15)23)25-19(28)13(22)6-4-5-11-21/h2-3,7-10,13H,4-6,11-12,21-22H2,1H3,(H3,23,24,25,28)/b27-26+/t13-/m0/s1 |
| InChIKey | DFOBZASGGWTDLB-IEUSNURDSA-N |
| XLogP | 2.59 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|