C21H27N7O3 — CID 164908592
[2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-piperidin-1-ylacetate (PubChem CID 164908592) has the molecular formula C21H27N7O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-piperidin-1-ylacetate.
| Compound Name | [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 164908592 |
| Molecular Formula | C21H27N7O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenyl] 2-piperidin-1-ylacetate |
| SMILES | C[C@H](N)C(=O)Nc1ccc(/N=N/c2ccccc2OC(=O)CN2CCCCC2)c(N)n1 |
| InChI | InChI=1S/C21H27N7O3/c1-14(22)21(30)25-18-10-9-16(20(23)24-18)27-26-15-7-3-4-8-17(15)31-19(29)13-28-11-5-2-6-12-28/h3-4,7-10,14H,2,5-6,11-13,22H2,1H3,(H3,23,24,25,30)/b27-26+/t14-/m0/s1 |
| InChIKey | TXLRDYNHXIODKB-XFJJUJPYSA-N |
| XLogP | 2.76 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|