C28H34N6O3 — CID 150396261
N-[3-[[3-(dimethylamino)-6-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2-pyridinyl]oxy]phenyl]prop-2-enamide (PubChem CID 150396261) has the molecular formula C28H34N6O3 and a molecular weight of 502.62 g/mol. Its IUPAC name is N-[3-[[3-(dimethylamino)-6-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2-pyridinyl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[3-(dimethylamino)-6-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2-pyridinyl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 150396261 |
| Molecular Formula | C28H34N6O3 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | N-[3-[[3-(dimethylamino)-6-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2-pyridinyl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)cc3OC)ccc2N(C)C)c1 |
| InChI | InChI=1S/C28H34N6O3/c1-6-27(35)29-20-8-7-9-22(18-20)37-28-24(32(2)3)12-13-26(31-28)30-23-11-10-21(19-25(23)36-5)34-16-14-33(4)15-17-34/h6-13,18-19H,1,14-17H2,2-5H3,(H,29,35)(H,30,31) |
| InChIKey | HCUGVXANZBUVFP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|