C26H34N4O4 — CID 647847
N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethoxyphenyl)-N-pyridin-2-ylpentanediamide (PubChem CID 647847) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethoxyphenyl)-N-pyridin-2-ylpentanediamide.
| Compound Name | N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethoxyphenyl)-N-pyridin-2-ylpentanediamide |
|---|---|
| PubChem CID | 647847 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethoxyphenyl)-N-pyridin-2-ylpentanediamide |
| SMILES | CCOc1ccccc1N(CC(=O)NC1CCCCC1)C(=O)CCCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C26H34N4O4/c1-2-34-22-14-7-6-13-21(22)30(19-25(32)28-20-11-4-3-5-12-20)26(33)17-10-16-24(31)29-23-15-8-9-18-27-23/h6-9,13-15,18,20H,2-5,10-12,16-17,19H2,1H3,(H,28,32)(H,27,29,31) |
| InChIKey | RYRDUGOFWOTODW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |