C25H32N4O3 — CID 3197396
N'-[2-(cyclopentylamino)-2-oxoethyl]-N'-(4-ethylphenyl)-N-pyridin-2-ylpentanediamide (PubChem CID 3197396) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N'-[2-(cyclopentylamino)-2-oxoethyl]-N'-(4-ethylphenyl)-N-pyridin-2-ylpentanediamide.
| Compound Name | N'-[2-(cyclopentylamino)-2-oxoethyl]-N'-(4-ethylphenyl)-N-pyridin-2-ylpentanediamide |
|---|---|
| PubChem CID | 3197396 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N'-[2-(cyclopentylamino)-2-oxoethyl]-N'-(4-ethylphenyl)-N-pyridin-2-ylpentanediamide |
| SMILES | CCc1ccc(N(CC(=O)NC2CCCC2)C(=O)CCCC(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-2-19-13-15-21(16-14-19)29(18-24(31)27-20-8-3-4-9-20)25(32)12-7-11-23(30)28-22-10-5-6-17-26-22/h5-6,10,13-17,20H,2-4,7-9,11-12,18H2,1H3,(H,27,31)(H,26,28,30) |
| InChIKey | QHVCRLARWJCAAD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |