C19H25N7O3 — CID 164908596
[2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 164908596) has the molecular formula C19H25N7O3 and a molecular weight of 399.46 g/mol. Its IUPAC name is [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 164908596 |
| Molecular Formula | C19H25N7O3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [2-[[2-amino-6-[[(2S)-2-aminopropanoyl]amino]-3-pyridinyl]diazenyl]phenyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)Oc1ccccc1/N=N/c1ccc(NC(=O)[C@H](C)N)nc1N |
| InChI | InChI=1S/C19H25N7O3/c1-10(2)16(21)19(28)29-14-7-5-4-6-12(14)25-26-13-8-9-15(23-17(13)22)24-18(27)11(3)20/h4-11,16H,20-21H2,1-3H3,(H3,22,23,24,27)/b26-25+/t11-,16-/m0/s1 |
| InChIKey | NIIIYLCWQBGAFW-YLAZSRFLSA-N |
| XLogP | 2.25 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|