C16H22N6O3 — CID 164908608
2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;(2-aminophenyl) propanoate (PubChem CID 164908608) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;(2-aminophenyl) propanoate.
| Compound Name | 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;(2-aminophenyl) propanoate |
|---|---|
| PubChem CID | 164908608 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;(2-aminophenyl) propanoate |
| SMILES | CCC(=O)Oc1ccccc1N.NCC(=O)Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C9H11NO2.C7H11N5O/c1-2-9(11)12-8-6-4-3-5-7(8)10;8-3-6(13)11-5-2-1-4(9)7(10)12-5/h3-6H,2,10H2,1H3;1-2H,3,8-9H2,(H3,10,11,12,13) |
| InChIKey | RKDHOFNDNJMLPK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 172.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|