C19H29N7O3 — CID 164909199
3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;(2-aminophenyl) 2-amino-3-methylbutanoate (PubChem CID 164909199) has the molecular formula C19H29N7O3 and a molecular weight of 403.49 g/mol. Its IUPAC name is 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;(2-aminophenyl) 2-amino-3-methylbutanoate.
| Compound Name | 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;(2-aminophenyl) 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 164909199 |
| Molecular Formula | C19H29N7O3 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;(2-aminophenyl) 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)Oc1ccccc1N.NCCC(=O)Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C11H16N2O2.C8H13N5O/c1-7(2)10(13)11(14)15-9-6-4-3-5-8(9)12;9-4-3-7(14)12-6-2-1-5(10)8(11)13-6/h3-7,10H,12-13H2,1-2H3;1-2H,3-4,9-10H2,(H3,11,12,13,14) |
| InChIKey | CNDSQSUYIADYHH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 198.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|