C15H16ClN3O2 — CID 84551760
4-(2-aminophenoxy)-N-(5-chloro-2-pyridinyl)butanamide (PubChem CID 84551760) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 4-(2-aminophenoxy)-N-(5-chloro-2-pyridinyl)butanamide.
| Compound Name | 4-(2-aminophenoxy)-N-(5-chloro-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 84551760 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-(2-aminophenoxy)-N-(5-chloro-2-pyridinyl)butanamide |
| SMILES | Nc1ccccc1OCCCC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-11-7-8-14(18-10-11)19-15(20)6-3-9-21-13-5-2-1-4-12(13)17/h1-2,4-5,7-8,10H,3,6,9,17H2,(H,18,19,20) |
| InChIKey | QAFKFJQUCNSTBN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|