C16H15Cl3N2O2 — CID 84553914
4-(2-aminophenoxy)-N-(2,4,5-trichlorophenyl)butanamide (PubChem CID 84553914) has the molecular formula C16H15Cl3N2O2 and a molecular weight of 373.67 g/mol. Its IUPAC name is 4-(2-aminophenoxy)-N-(2,4,5-trichlorophenyl)butanamide.
| Compound Name | 4-(2-aminophenoxy)-N-(2,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 84553914 |
| Molecular Formula | C16H15Cl3N2O2 |
| Molecular Weight | 373.67 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 4-(2-aminophenoxy)-N-(2,4,5-trichlorophenyl)butanamide |
| SMILES | Nc1ccccc1OCCCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl3N2O2/c17-10-8-12(19)14(9-11(10)18)21-16(22)6-3-7-23-15-5-2-1-4-13(15)20/h1-2,4-5,8-9H,3,6-7,20H2,(H,21,22) |
| InChIKey | JBIYZJOSFNXOAB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|