C12H18N4O3 — CID 25200925
(2R)-2,6-diamino-N-(4-nitrophenyl)hexanamide (PubChem CID 25200925) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2R)-2,6-diamino-N-(4-nitrophenyl)hexanamide.
| Compound Name | (2R)-2,6-diamino-N-(4-nitrophenyl)hexanamide |
|---|---|
| PubChem CID | 25200925 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2R)-2,6-diamino-N-(4-nitrophenyl)hexanamide |
| SMILES | NCCCC[C@@H](N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N4O3/c13-8-2-1-3-11(14)12(17)15-9-4-6-10(7-5-9)16(18)19/h4-7,11H,1-3,8,13-14H2,(H,15,17)/t11-/m1/s1 |
| InChIKey | VUUNELJIFNFWJC-LLVKDONJSA-N |
| XLogP | 0.99 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|