C23H42N6O7 — CID 158153530
(2R)-2-amino-3-methylbutanoic acid;(2S)-2-amino-4-methylpentanoic acid;(2S)-2,6-diamino-N-(4-nitrophenyl)hexanamide (PubChem CID 158153530) has the molecular formula C23H42N6O7 and a molecular weight of 514.62 g/mol. Its IUPAC name is (2R)-2-amino-3-methylbutanoic acid;(2S)-2-amino-4-methylpentanoic acid;(2S)-2,6-diamino-N-(4-nitrophenyl)hexanamide.
| Compound Name | (2R)-2-amino-3-methylbutanoic acid;(2S)-2-amino-4-methylpentanoic acid;(2S)-2,6-diamino-N-(4-nitrophenyl)hexanamide |
|---|---|
| PubChem CID | 158153530 |
| Molecular Formula | C23H42N6O7 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | (2R)-2-amino-3-methylbutanoic acid;(2S)-2-amino-4-methylpentanoic acid;(2S)-2,6-diamino-N-(4-nitrophenyl)hexanamide |
| SMILES | CC(C)C[C@H](N)C(=O)O.CC(C)[C@@H](N)C(=O)O.NCCCC[C@H](N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N4O3.C6H13NO2.C5H11NO2/c13-8-2-1-3-11(14)12(17)15-9-4-6-10(7-5-9)16(18)19;1-4(2)3-5(7)6(8)9;1-3(2)4(6)5(7)8/h4-7,11H,1-3,8,13-14H2,(H,15,17);4-5H,3,7H2,1-2H3,(H,8,9);3-4H,6H2,1-2H3,(H,7,8)/t11-;5-;4-/m001/s1 |
| InChIKey | FVKHJLOZQXCYOL-BZVLYADJSA-N |
| XLogP | 1.49 |
| TPSA | 250.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|