C14H32N4O6 — CID 134498340
2-amino-3-methylbutanoic acid;2-aminopropanoic acid;2,6-diaminohexanoic acid (PubChem CID 134498340) has the molecular formula C14H32N4O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-amino-3-methylbutanoic acid;2-aminopropanoic acid;2,6-diaminohexanoic acid.
| Compound Name | 2-amino-3-methylbutanoic acid;2-aminopropanoic acid;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 134498340 |
| Molecular Formula | C14H32N4O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-amino-3-methylbutanoic acid;2-aminopropanoic acid;2,6-diaminohexanoic acid |
| SMILES | CC(C)C(N)C(=O)O.CC(N)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C5H11NO2.C3H7NO2/c7-4-2-1-3-5(8)6(9)10;1-3(2)4(6)5(7)8;1-2(4)3(5)6/h5H,1-4,7-8H2,(H,9,10);3-4H,6H2,1-2H3,(H,7,8);2H,4H2,1H3,(H,5,6) |
| InChIKey | HLALFGYCILKCAJ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 215.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|